C11H12BrNO3 — CID 94813092
methyl (2R)-2-acetamido-2-(4-bromophenyl)acetate (PubChem CID 94813092) has the molecular formula C11H12BrNO3 and a molecular weight of 286.13 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-2-(4-bromophenyl)acetate.
| Compound Name | methyl (2R)-2-acetamido-2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 94813092 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | methyl (2R)-2-acetamido-2-(4-bromophenyl)acetate |
| SMILES | COC(=O)[C@H](NC(C)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrNO3/c1-7(14)13-10(11(15)16-2)8-3-5-9(12)6-4-8/h3-6,10H,1-2H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | KLBMBSNKYPGCAR-SNVBAGLBSA-N |
| XLogP | 1.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |