C14H18BrNO4S — CID 47085619
methyl 2-(4-bromophenyl)-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]acetate (PubChem CID 47085619) has the molecular formula C14H18BrNO4S and a molecular weight of 376.27 g/mol. Its IUPAC name is methyl 2-(4-bromophenyl)-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]acetate.
| Compound Name | methyl 2-(4-bromophenyl)-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 47085619 |
| Molecular Formula | C14H18BrNO4S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | methyl 2-(4-bromophenyl)-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]acetate |
| SMILES | COCCSCC(=O)NC(C(=O)OC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrNO4S/c1-19-7-8-21-9-12(17)16-13(14(18)20-2)10-3-5-11(15)6-4-10/h3-6,13H,7-9H2,1-2H3,(H,16,17) |
| InChIKey | XOEWIGHNAYGIDM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|