C12H14BrNO4S — CID 9277750
methyl (2S)-2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-3-hydroxypropanoate (PubChem CID 9277750) has the molecular formula C12H14BrNO4S and a molecular weight of 348.22 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9277750 |
| Molecular Formula | C12H14BrNO4S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | methyl (2S)-2-[[2-(4-bromophenyl)sulfanylacetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H14BrNO4S/c1-18-12(17)10(6-15)14-11(16)7-19-9-4-2-8(13)3-5-9/h2-5,10,15H,6-7H2,1H3,(H,14,16)/t10-/m0/s1 |
| InChIKey | LZTNQURCTWJSRV-JTQLQIEISA-N |
| XLogP | 1.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |