C13H17NO5S — CID 9277983
methyl (2S)-3-hydroxy-2-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]propanoate (PubChem CID 9277983) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is methyl (2S)-3-hydroxy-2-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]propanoate.
| Compound Name | methyl (2S)-3-hydroxy-2-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]propanoate |
|---|---|
| PubChem CID | 9277983 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl (2S)-3-hydroxy-2-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)CSc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H17NO5S/c1-18-9-3-5-10(6-4-9)20-8-12(16)14-11(7-15)13(17)19-2/h3-6,11,15H,7-8H2,1-2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | GNJKFUDNXOEWLH-NSHDSACASA-N |
| XLogP | 0.44 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |