C18H18BrNO2S — CID 8707512
2-(4-bromophenyl)sulfanyl-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide (PubChem CID 8707512) has the molecular formula C18H18BrNO2S and a molecular weight of 392.32 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 8707512 |
| Molecular Formula | C18H18BrNO2S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrNO2S/c1-13(21)17(11-14-5-3-2-4-6-14)20-18(22)12-23-16-9-7-15(19)8-10-16/h2-10,17H,11-12H2,1H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | FNQYLVAQOWCNRV-KRWDZBQOSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |