C15H19NO4S — CID 18275432
methyl 2-[2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl]sulfanylacetate (PubChem CID 18275432) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 2-[2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl]sulfanylacetate.
| Compound Name | methyl 2-[2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 18275432 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 2-[2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl]sulfanylacetate |
| SMILES | COC(=O)CSCC(=O)NC(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C15H19NO4S/c1-11(17)13(8-12-6-4-3-5-7-12)16-14(18)9-21-10-15(19)20-2/h3-7,13H,8-10H2,1-2H3,(H,16,18) |
| InChIKey | FZWILEVBKVLMOV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |