C13H17NO3S — CID 18078994
methyl 2-[2-oxo-2-(1-phenylethylamino)ethyl]sulfanylacetate (PubChem CID 18078994) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 2-[2-oxo-2-(1-phenylethylamino)ethyl]sulfanylacetate.
| Compound Name | methyl 2-[2-oxo-2-(1-phenylethylamino)ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 18078994 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methyl 2-[2-oxo-2-(1-phenylethylamino)ethyl]sulfanylacetate |
| SMILES | COC(=O)CSCC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3S/c1-10(11-6-4-3-5-7-11)14-12(15)8-18-9-13(16)17-2/h3-7,10H,8-9H2,1-2H3,(H,14,15) |
| InChIKey | BJFZZJQVMCABDA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |