C11H10BrClFNO3 — CID 166427854
methyl 2-(4-bromophenyl)-2-[(2-chloro-2-fluoroacetyl)amino]acetate (PubChem CID 166427854) has the molecular formula C11H10BrClFNO3 and a molecular weight of 338.56 g/mol. Its IUPAC name is methyl 2-(4-bromophenyl)-2-[(2-chloro-2-fluoroacetyl)amino]acetate.
| Compound Name | methyl 2-(4-bromophenyl)-2-[(2-chloro-2-fluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 166427854 |
| Molecular Formula | C11H10BrClFNO3 |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | methyl 2-(4-bromophenyl)-2-[(2-chloro-2-fluoroacetyl)amino]acetate |
| SMILES | COC(=O)C(NC(=O)C(F)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H10BrClFNO3/c1-18-11(17)8(15-10(16)9(13)14)6-2-4-7(12)5-3-6/h2-5,8-9H,1H3,(H,15,16) |
| InChIKey | XCRPULATYRKDKN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|