C16H16BrClN4O2 — CID 96998138
(2S)-2-(3-bromophenyl)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]acetamide (PubChem CID 96998138) has the molecular formula C16H16BrClN4O2 and a molecular weight of 411.69 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]acetamide.
| Compound Name | (2S)-2-(3-bromophenyl)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 96998138 |
| Molecular Formula | C16H16BrClN4O2 |
| Molecular Weight | 411.69 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]acetamide |
| SMILES | CN(CC(=O)N[C@H](C(N)=O)c1cccc(Br)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H16BrClN4O2/c1-22(13-6-5-12(18)8-20-13)9-14(23)21-15(16(19)24)10-3-2-4-11(17)7-10/h2-8,15H,9H2,1H3,(H2,19,24)(H,21,23)/t15-/m0/s1 |
| InChIKey | OMRJEISCJUPAGZ-HNNXBMFYSA-N |
| XLogP | 2.28 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |