C17H29ClN4O — CID 51108150
2-[(5-chloro-2-pyridinyl)-methylamino]-N-[5-(diethylamino)pentan-2-yl]acetamide (PubChem CID 51108150) has the molecular formula C17H29ClN4O and a molecular weight of 340.90 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)-methylamino]-N-[5-(diethylamino)pentan-2-yl]acetamide.
| Compound Name | 2-[(5-chloro-2-pyridinyl)-methylamino]-N-[5-(diethylamino)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 51108150 |
| Molecular Formula | C17H29ClN4O |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)-methylamino]-N-[5-(diethylamino)pentan-2-yl]acetamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)CN(C)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C17H29ClN4O/c1-5-22(6-2)11-7-8-14(3)20-17(23)13-21(4)16-10-9-15(18)12-19-16/h9-10,12,14H,5-8,11,13H2,1-4H3,(H,20,23) |
| InChIKey | AGUGNILCCYCGCA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |