C13H18ClN3O3S — CID 43353427
2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 43353427) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is 2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43353427 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)CN(C)c1ccc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C13H18ClN3O3S/c1-17(11-4-3-9(14)7-15-11)8-12(18)16-10(13(19)20)5-6-21-2/h3-4,7,10H,5-6,8H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | VWWUZUVHGBBPGW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |