C14H20ClN3O3 — CID 79813313
2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-2-ethylbutanoic acid (PubChem CID 79813313) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-2-ethylbutanoic acid.
| Compound Name | 2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 79813313 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(NC(=O)CN(C)c1ccc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C14H20ClN3O3/c1-4-14(5-2,13(20)21)17-12(19)9-18(3)11-7-6-10(15)8-16-11/h6-8H,4-5,9H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | PIUYDJKZSWZSRS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |