C13H18ClN3O3 — CID 107563108
(2R)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]pentanoic acid (PubChem CID 107563108) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is (2R)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]pentanoic acid.
| Compound Name | (2R)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107563108 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (2R)-2-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)CN(C)c1ccc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C13H18ClN3O3/c1-3-4-10(13(19)20)16-12(18)8-17(2)11-6-5-9(14)7-15-11/h5-7,10H,3-4,8H2,1-2H3,(H,16,18)(H,19,20)/t10-/m1/s1 |
| InChIKey | XRKRGBGAQCKSAD-SNVBAGLBSA-N |
| XLogP | 1.54 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |