C9H18N2O3 — CID 107564391
(2S)-2-[[2-(dimethylamino)acetyl]amino]pentanoic acid (PubChem CID 107564391) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2S)-2-[[2-(dimethylamino)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[2-(dimethylamino)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107564391 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (2S)-2-[[2-(dimethylamino)acetyl]amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)CN(C)C)C(=O)O |
| InChI | InChI=1S/C9H18N2O3/c1-4-5-7(9(13)14)10-8(12)6-11(2)3/h7H,4-6H2,1-3H3,(H,10,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | NKAHAPDYZBXWKB-ZETCQYMHSA-N |
| XLogP | -0.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |