2-[(2-cyclopropylacetyl)amino]pentanoic acid

C10H17NO3 — CID 43630437

IUPAC2-[(2-cyclopropylacetyl)amino]pentanoic acid
SMILESCCCC(NC(=O)CC1CC1)C(=O)O
InChIInChI=1S/C10H17NO3/c1-2-3-8(10(13)14)11-9(12)6-7-4-5-7/h7-8H,2-6H2,1H3,(H,11,12)(H,13,14)
InChIKeyFBTOVOLEEGTMLY-UHFFFAOYSA-N
MW199.25 g/mol
LogP1.16
Rot. Bonds6

About 2-[(2-cyclopropylacetyl)amino]pentanoic acid

2-[(2-cyclopropylacetyl)amino]pentanoic acid (PubChem CID 43630437) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[(2-cyclopropylacetyl)amino]pentanoic acid.

Molecular Properties

Compound Name2-[(2-cyclopropylacetyl)amino]pentanoic acid
PubChem CID43630437
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Name2-[(2-cyclopropylacetyl)amino]pentanoic acid
SMILESCCCC(NC(=O)CC1CC1)C(=O)O
InChIInChI=1S/C10H17NO3/c1-2-3-8(10(13)14)11-9(12)6-7-4-5-7/h7-8H,2-6H2,1H3,(H,11,12)(H,13,14)
InChIKeyFBTOVOLEEGTMLY-UHFFFAOYSA-N
XLogP1.16
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 51.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2-cyclopropylacetyl)amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(2-cyclopropylacetyl)amino]hexanoic acid
CID 43469695
2-[(2-cyclopentylacetyl)amino]hexanoic acid
CID 60657212
2-(3-cyclopropylpropanoylamino)pentanoic acid
CID 115923947
(2S)-2-[(2-cyclopropylacetyl)amino]pentanedioic acid
CID 61151881
(2S)-2-[(2-cyclopropylacetyl)amino]-4-methylpentanoic acid
CID 61136657
2-[(2-cycloheptylacetyl)amino]butanoic acid
CID 115909894
(2S)-2-[(2-cyclobutylacetyl)amino]-4-hydroxybutanoic acid
CID 107822267
2-[(2-cyclobutylacetyl)amino]-4-hydroxybutanoic acid
CID 103161841
2-[(2-cyclohexylacetyl)amino]-4-methylsulfonylbutanoic acid
CID 43107936
(2R)-2-[(2-pyrrolidin-2-ylacetyl)amino]pentanoic acid
CID 103869971
(2S)-2-[(2-cyclopropylacetyl)amino]-4-methoxy-4-oxobutanoic acid
CID 63306811
2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]pentanoic acid
CID 43630318

Frequently Asked Questions

What is the IUPAC name of 2-[(2-cyclopropylacetyl)amino]pentanoic acid?
The IUPAC name of 2-[(2-cyclopropylacetyl)amino]pentanoic acid (CID 43630437) is 2-[(2-cyclopropylacetyl)amino]pentanoic acid.
What is the SMILES notation for 2-[(2-cyclopropylacetyl)amino]pentanoic acid?
The canonical SMILES for 2-[(2-cyclopropylacetyl)amino]pentanoic acid is CCCC(NC(=O)CC1CC1)C(=O)O.
What is the InChIKey of 2-[(2-cyclopropylacetyl)amino]pentanoic acid?
The InChIKey is FBTOVOLEEGTMLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-2-3-8(10(13)14)11-9(12)6-7-4-5-7/h7-8H,2-6H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-[(2-cyclopropylacetyl)amino]pentanoic acid?
2-[(2-cyclopropylacetyl)amino]pentanoic acid has a molecular weight of 199.25 g/mol, XLogP of 1.16, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-cyclopropylacetyl)amino]pentanoic acid is sourced from PubChem (CID 43630437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).