C10H17NO4 — CID 103161841
2-[(2-cyclobutylacetyl)amino]-4-hydroxybutanoic acid (PubChem CID 103161841) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[(2-cyclobutylacetyl)amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(2-cyclobutylacetyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 103161841 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-[(2-cyclobutylacetyl)amino]-4-hydroxybutanoic acid |
| SMILES | O=C(CC1CCC1)NC(CCO)C(=O)O |
| InChI | InChI=1S/C10H17NO4/c12-5-4-8(10(14)15)11-9(13)6-7-2-1-3-7/h7-8,12H,1-6H2,(H,11,13)(H,14,15) |
| InChIKey | OGEYWODTVKEVBI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |