C14H20ClN3O3 — CID 61344211
ethyl 4-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]butanoate (PubChem CID 61344211) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is ethyl 4-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 61344211 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl 4-[[2-[(5-chloro-2-pyridinyl)-methylamino]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CN(C)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H20ClN3O3/c1-3-21-14(20)5-4-8-16-13(19)10-18(2)12-7-6-11(15)9-17-12/h6-7,9H,3-5,8,10H2,1-2H3,(H,16,19) |
| InChIKey | PGEWUQLXSZRJGO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|