C14H23ClN4O — CID 107252414
5-chloro-N-[5-(diethylamino)pentan-2-yl]pyrazine-2-carboxamide (PubChem CID 107252414) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 5-chloro-N-[5-(diethylamino)pentan-2-yl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[5-(diethylamino)pentan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107252414 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5-chloro-N-[5-(diethylamino)pentan-2-yl]pyrazine-2-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C14H23ClN4O/c1-4-19(5-2)8-6-7-11(3)18-14(20)12-9-17-13(15)10-16-12/h9-11H,4-8H2,1-3H3,(H,18,20) |
| InChIKey | WDXVEBFTKFDFGD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |