C10H14ClN3OS — CID 107257777
5-chloro-N-(4-methylsulfanylbutan-2-yl)pyrazine-2-carboxamide (PubChem CID 107257777) has the molecular formula C10H14ClN3OS and a molecular weight of 259.76 g/mol. Its IUPAC name is 5-chloro-N-(4-methylsulfanylbutan-2-yl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-(4-methylsulfanylbutan-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107257777 |
| Molecular Formula | C10H14ClN3OS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-chloro-N-(4-methylsulfanylbutan-2-yl)pyrazine-2-carboxamide |
| SMILES | CSCCC(C)NC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C10H14ClN3OS/c1-7(3-4-16-2)14-10(15)8-5-13-9(11)6-12-8/h5-7H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | LUKLWENLXFSPGW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |