C10H14ClN3O3 — CID 107372068
5-chloro-N-(1,1-dimethoxypropan-2-yl)pyrazine-2-carboxamide (PubChem CID 107372068) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is 5-chloro-N-(1,1-dimethoxypropan-2-yl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-(1,1-dimethoxypropan-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107372068 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 5-chloro-N-(1,1-dimethoxypropan-2-yl)pyrazine-2-carboxamide |
| SMILES | COC(OC)C(C)NC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C10H14ClN3O3/c1-6(10(16-2)17-3)14-9(15)7-4-13-8(11)5-12-7/h4-6,10H,1-3H3,(H,14,15) |
| InChIKey | KMTBRXXDEVSQGV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|