C8H8ClN3O3 — CID 107371387
2-[(5-chloropyrazine-2-carbonyl)amino]propanoic acid (PubChem CID 107371387) has the molecular formula C8H8ClN3O3 and a molecular weight of 229.62 g/mol. Its IUPAC name is 2-[(5-chloropyrazine-2-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(5-chloropyrazine-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 107371387 |
| Molecular Formula | C8H8ClN3O3 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-[(5-chloropyrazine-2-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1cnc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C8H8ClN3O3/c1-4(8(14)15)12-7(13)5-2-11-6(9)3-10-5/h2-4H,1H3,(H,12,13)(H,14,15) |
| InChIKey | ZDOHQIWWYDESGX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |