C10H12ClN3O3 — CID 107371621
4-[(5-chloropyrazine-2-carbonyl)amino]-2-methylbutanoic acid (PubChem CID 107371621) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is 4-[(5-chloropyrazine-2-carbonyl)amino]-2-methylbutanoic acid.
| Compound Name | 4-[(5-chloropyrazine-2-carbonyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 107371621 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-[(5-chloropyrazine-2-carbonyl)amino]-2-methylbutanoic acid |
| SMILES | CC(CCNC(=O)c1cnc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C10H12ClN3O3/c1-6(10(16)17)2-3-12-9(15)7-4-14-8(11)5-13-7/h4-6H,2-3H2,1H3,(H,12,15)(H,16,17) |
| InChIKey | WLKGOAPRCVLSGX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |