C8H8ClN3O4 — CID 107371398
2-[(5-chloropyrazine-2-carbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 107371398) has the molecular formula C8H8ClN3O4 and a molecular weight of 245.62 g/mol. Its IUPAC name is 2-[(5-chloropyrazine-2-carbonyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(5-chloropyrazine-2-carbonyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107371398 |
| Molecular Formula | C8H8ClN3O4 |
| Molecular Weight | 245.62 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 2-[(5-chloropyrazine-2-carbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(NC(CO)C(=O)O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C8H8ClN3O4/c9-6-2-10-4(1-11-6)7(14)12-5(3-13)8(15)16/h1-2,5,13H,3H2,(H,12,14)(H,15,16) |
| InChIKey | IBBVEUQVDAQFAQ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.62 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |