C13H18ClN3O3 — CID 107371683
3-[(5-chloropyrazine-2-carbonyl)amino]-5,5-dimethylhexanoic acid (PubChem CID 107371683) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is 3-[(5-chloropyrazine-2-carbonyl)amino]-5,5-dimethylhexanoic acid.
| Compound Name | 3-[(5-chloropyrazine-2-carbonyl)amino]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 107371683 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-[(5-chloropyrazine-2-carbonyl)amino]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CC(CC(=O)O)NC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C13H18ClN3O3/c1-13(2,3)5-8(4-11(18)19)17-12(20)9-6-16-10(14)7-15-9/h6-8H,4-5H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | KQTGVBKKUOONSD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |