C8H10ClN5O2 — CID 107372160
N-[2-(carbamoylamino)ethyl]-5-chloropyrazine-2-carboxamide (PubChem CID 107372160) has the molecular formula C8H10ClN5O2 and a molecular weight of 243.65 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-5-chloropyrazine-2-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-5-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107372160 |
| Molecular Formula | C8H10ClN5O2 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-5-chloropyrazine-2-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C8H10ClN5O2/c9-6-4-13-5(3-14-6)7(15)11-1-2-12-8(10)16/h3-4H,1-2H2,(H,11,15)(H3,10,12,16) |
| InChIKey | PQCCZGTWYKXPJD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|