C8H8ClN3O3 — CID 103817109
methyl 2-[(5-chloropyrazine-2-carbonyl)amino]acetate (PubChem CID 103817109) has the molecular formula C8H8ClN3O3 and a molecular weight of 229.62 g/mol. Its IUPAC name is methyl 2-[(5-chloropyrazine-2-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(5-chloropyrazine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 103817109 |
| Molecular Formula | C8H8ClN3O3 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | methyl 2-[(5-chloropyrazine-2-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C8H8ClN3O3/c1-15-7(13)4-12-8(14)5-2-11-6(9)3-10-5/h2-3H,4H2,1H3,(H,12,14) |
| InChIKey | SMLIRPLALDCABP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |