C26H23FN2O2 — CID 92730547
[(1R)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-fluorophenyl)methanone (PubChem CID 92730547) has the molecular formula C26H23FN2O2 and a molecular weight of 414.48 g/mol. Its IUPAC name is [(1R)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(1R)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 92730547 |
| Molecular Formula | C26H23FN2O2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(1R)-1-(3-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-fluorophenyl)methanone |
| SMILES | CCOc1cccc([C@@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H23FN2O2/c1-2-31-20-7-5-6-18(16-20)25-24-22(21-8-3-4-9-23(21)28-24)14-15-29(25)26(30)17-10-12-19(27)13-11-17/h3-13,16,25,28H,2,14-15H2,1H3/t25-/m1/s1 |
| InChIKey | MRNCOSRKMLZQQK-RUZDIDTESA-N |
| XLogP | 5.49 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|