C26H25N3O2 — CID 45174221
[1-(4-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone (PubChem CID 45174221) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone.
| Compound Name | [1-(4-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 45174221 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | [1-(4-ethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(6-methyl-2-pyridinyl)methanone |
| SMILES | CCOc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)c2cccc(C)n2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-3-31-19-13-11-18(12-14-19)25-24-21(20-8-4-5-9-22(20)28-24)15-16-29(25)26(30)23-10-6-7-17(2)27-23/h4-14,25,28H,3,15-16H2,1-2H3 |
| InChIKey | AYYSTGDGCVULJV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|