C22H26N2O2Si — CID 23113736
methyl 1-(3-trimethylsilylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 23113736) has the molecular formula C22H26N2O2Si and a molecular weight of 378.55 g/mol. Its IUPAC name is methyl 1-(3-trimethylsilylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | methyl 1-(3-trimethylsilylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 23113736 |
| Molecular Formula | C22H26N2O2Si |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | methyl 1-(3-trimethylsilylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COC(=O)N1CCc2c([nH]c3ccccc23)C1c1cccc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C22H26N2O2Si/c1-26-22(25)24-13-12-18-17-10-5-6-11-19(17)23-20(18)21(24)15-8-7-9-16(14-15)27(2,3)4/h5-11,14,21,23H,12-13H2,1-4H3 |
| InChIKey | AZKSCVLZBPAXIZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|