C26H24N2O — CID 92502304
(2-methylphenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 92502304) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is (2-methylphenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (2-methylphenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 92502304 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (2-methylphenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | Cc1cccc([C@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C26H24N2O/c1-17-8-7-10-19(16-17)25-24-22(21-12-5-6-13-23(21)27-24)14-15-28(25)26(29)20-11-4-3-9-18(20)2/h3-13,16,25,27H,14-15H2,1-2H3/t25-/m0/s1 |
| InChIKey | BVICZSRZTNZFEA-VWLOTQADSA-N |
| XLogP | 5.57 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|