C24H22N4O — CID 92734660
(1R)-N-(3-methylphenyl)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 92734660) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is (1R)-N-(3-methylphenyl)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | (1R)-N-(3-methylphenyl)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 92734660 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (1R)-N-(3-methylphenyl)-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCc3c([nH]c4ccccc34)[C@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C24H22N4O/c1-16-6-4-8-18(14-16)26-24(29)28-13-11-20-19-9-2-3-10-21(19)27-22(20)23(28)17-7-5-12-25-15-17/h2-10,12,14-15,23,27H,11,13H2,1H3,(H,26,29)/t23-/m1/s1 |
| InChIKey | LJJFCMDJRQSTAW-HSZRJFAPSA-N |
| XLogP | 5.05 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|