C25H21ClN2O — CID 92502306
(2-chlorophenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 92502306) has the molecular formula C25H21ClN2O and a molecular weight of 400.91 g/mol. Its IUPAC name is (2-chlorophenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (2-chlorophenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 92502306 |
| Molecular Formula | C25H21ClN2O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (2-chlorophenyl)-[(1S)-1-(3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | Cc1cccc([C@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H21ClN2O/c1-16-7-6-8-17(15-16)24-23-19(18-9-3-5-12-22(18)27-23)13-14-28(24)25(29)20-10-2-4-11-21(20)26/h2-12,15,24,27H,13-14H2,1H3/t24-/m0/s1 |
| InChIKey | BYZLIIWAZGNGHZ-DEOSSOPVSA-N |
| XLogP | 5.92 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|