C24H19ClN3O3- — CID 163127035
(2-chlorophenyl)-[1-[4-[hydroxy(oxido)amino]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 163127035) has the molecular formula C24H19ClN3O3- and a molecular weight of 432.89 g/mol. Its IUPAC name is (2-chlorophenyl)-[1-[4-[hydroxy(oxido)amino]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (2-chlorophenyl)-[1-[4-[hydroxy(oxido)amino]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 163127035 |
| Molecular Formula | C24H19ClN3O3- |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (2-chlorophenyl)-[1-[4-[hydroxy(oxido)amino]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCc2c([nH]c3ccccc23)C1c1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C24H19ClN3O3/c25-20-7-3-1-6-19(20)24(29)27-14-13-18-17-5-2-4-8-21(17)26-22(18)23(27)15-9-11-16(12-10-15)28(30)31/h1-12,23,26,30H,13-14H2/q-1 |
| InChIKey | XJZLGLDQEBNOFZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|