C24H18ClN3O3 — CID 1253612
[(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-nitrophenyl)methanone (PubChem CID 1253612) has the molecular formula C24H18ClN3O3 and a molecular weight of 431.88 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 1253612 |
| Molecular Formula | C24H18ClN3O3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18ClN3O3/c25-17-9-5-15(6-10-17)23-22-20(19-3-1-2-4-21(19)26-22)13-14-27(23)24(29)16-7-11-18(12-8-16)28(30)31/h1-12,23,26H,13-14H2/t23-/m0/s1 |
| InChIKey | KZYLIFUHWPPPSL-QHCPKHFHSA-N |
| XLogP | 5.52 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|