C25H21BrN2O2 — CID 1019699
(2-bromophenyl)-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 1019699) has the molecular formula C25H21BrN2O2 and a molecular weight of 461.36 g/mol. Its IUPAC name is (2-bromophenyl)-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (2-bromophenyl)-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 1019699 |
| Molecular Formula | C25H21BrN2O2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (2-bromophenyl)-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COc1ccc([C@@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C25H21BrN2O2/c1-30-17-12-10-16(11-13-17)24-23-19(18-6-3-5-9-22(18)27-23)14-15-28(24)25(29)20-7-2-4-8-21(20)26/h2-13,24,27H,14-15H2,1H3/t24-/m1/s1 |
| InChIKey | IHYVKBVHQBRKTD-XMMPIXPASA-N |
| XLogP | 5.73 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|