C25H29N3O4 — CID 145281640
tert-butyl N-[2-[1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate (PubChem CID 145281640) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 145281640 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | tert-butyl N-[2-[1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate |
| SMILES | COc1cccc(C2c3[nH]c4ccccc4c3CCN2C(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H29N3O4/c1-25(2,3)32-24(30)26-15-21(29)28-13-12-19-18-10-5-6-11-20(18)27-22(19)23(28)16-8-7-9-17(14-16)31-4/h5-11,14,23,27H,12-13,15H2,1-4H3,(H,26,30) |
| InChIKey | ASAAMTKFXGCRSA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|