C27H24ClN3O3 — CID 42705180
2-(4-chlorophenoxy)-N-[2-oxo-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]acetamide (PubChem CID 42705180) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-oxo-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-oxo-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 42705180 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-oxo-2-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NCC(=O)N1CCc2c([nH]c3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C27H24ClN3O3/c28-19-10-12-20(13-11-19)34-17-24(32)29-16-25(33)31-15-14-22-21-8-4-5-9-23(21)30-26(22)27(31)18-6-2-1-3-7-18/h1-13,27,30H,14-17H2,(H,29,32) |
| InChIKey | XBSJAHYWAPLPQD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|