C24H23N3O — CID 101454798
(1R)-N-[(1R)-1-naphthalen-1-ylethyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide (PubChem CID 101454798) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (1R)-N-[(1R)-1-naphthalen-1-ylethyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide.
| Compound Name | (1R)-N-[(1R)-1-naphthalen-1-ylethyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 101454798 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (1R)-N-[(1R)-1-naphthalen-1-ylethyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@H]1NCCc2c1[nH]c1ccccc21)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H23N3O/c1-15(17-11-6-8-16-7-2-3-9-18(16)17)26-24(28)23-22-20(13-14-25-23)19-10-4-5-12-21(19)27-22/h2-12,15,23,25,27H,13-14H2,1H3,(H,26,28)/t15-,23-/m1/s1 |
| InChIKey | WUHYZDYUQUQCCD-IQMFZBJNSA-N |
| XLogP | 4.39 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|