C16H21N3O — CID 70041117
N-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide (PubChem CID 70041117) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide.
| Compound Name | N-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 70041117 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C16H21N3O/c1-16(2,3)19-15(20)14-13-11(8-9-17-14)10-6-4-5-7-12(10)18-13/h4-7,14,17-18H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | ZEDDMPHFZMBJLV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|