C20H21ClN2O — CID 11772200
1-phenyl-2-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-one;hydrochloride (PubChem CID 11772200) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-phenyl-2-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-one;hydrochloride.
| Compound Name | 1-phenyl-2-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 11772200 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-phenyl-2-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-one;hydrochloride |
| SMILES | CC(C(=O)c1ccccc1)C1NCCc2c1[nH]c1ccccc21.Cl |
| InChI | InChI=1S/C20H20N2O.ClH/c1-13(20(23)14-7-3-2-4-8-14)18-19-16(11-12-21-18)15-9-5-6-10-17(15)22-19;/h2-10,13,18,21-22H,11-12H2,1H3;1H |
| InChIKey | TYOQLORLIIZCEN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|