C13H14N2O2 — CID 19868835
1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxylic acid (PubChem CID 19868835) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxylic acid.
| Compound Name | 1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 19868835 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxylic acid |
| SMILES | O=C(O)C1CNCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C13H14N2O2/c16-13(17)10-7-14-6-5-9-8-3-1-2-4-11(8)15-12(9)10/h1-4,10,14-15H,5-7H2,(H,16,17) |
| InChIKey | QRDPFJCAKWNQMT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |