C15H24N2 — CID 158166358
ethane;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 158166358) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | ethane;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 158166358 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | ethane;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CC.CC.c1ccc2c3c([nH]c2c1)CNCC3 |
| InChI | InChI=1S/C11H12N2.2C2H6/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;2*1-2/h1-4,12-13H,5-7H2;2*1-2H3 |
| InChIKey | FWWSFJTUWAAXGY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|