C13H17IN2 — CID 2752150
2,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium iodide (PubChem CID 2752150) has the molecular formula C13H17IN2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 2,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium iodide.
| Compound Name | 2,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium iodide |
|---|---|
| PubChem CID | 2752150 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2,2-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ium iodide |
| SMILES | C[N+]1(C)CCc2c([nH]c3ccccc23)C1.[I-] |
| InChI | InChI=1S/C13H17N2.HI/c1-15(2)8-7-11-10-5-3-4-6-12(10)14-13(11)9-15;/h3-6,14H,7-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HFHUKHVVCRUOTM-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|