C11H13N2+ — CID 6931422
2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 6931422) has the molecular formula C11H13N2+ and a molecular weight of 173.24 g/mol. Its IUPAC name is 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 6931422 |
| Molecular Formula | C11H13N2+ |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | c1ccc2c3c([nH]c2c1)C[NH2+]CC3 |
| InChI | InChI=1S/C11H12N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-4,12-13H,5-7H2/p+1 |
| InChIKey | CFTOTSJVQRFXOF-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|