C13H14N2O2 — CID 20529231
2,3,4,9-tetrahydro-1H-carbazol-2-ylcarbamic acid (PubChem CID 20529231) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2,3,4,9-tetrahydro-1H-carbazol-2-ylcarbamic acid.
| Compound Name | 2,3,4,9-tetrahydro-1H-carbazol-2-ylcarbamic acid |
|---|---|
| PubChem CID | 20529231 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2,3,4,9-tetrahydro-1H-carbazol-2-ylcarbamic acid |
| SMILES | O=C(O)NC1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C13H14N2O2/c16-13(17)14-8-5-6-10-9-3-1-2-4-11(9)15-12(10)7-8/h1-4,8,14-15H,5-7H2,(H,16,17) |
| InChIKey | XMAJDNMSRRWUGB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|