C23H20N2O — CID 84579674
N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)naphthalene-1-carboxamide (PubChem CID 84579674) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)naphthalene-1-carboxamide.
| Compound Name | N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 84579674 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)naphthalene-1-carboxamide |
| SMILES | O=C(NC1CCc2c([nH]c3ccccc23)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H20N2O/c26-23(20-10-5-7-15-6-1-2-8-17(15)20)24-16-12-13-19-18-9-3-4-11-21(18)25-22(19)14-16/h1-11,16,25H,12-14H2,(H,24,26) |
| InChIKey | FPGHMUNGVRAYHJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|