C19H17ClN2O — CID 84579227
2-chloro-N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide (PubChem CID 84579227) has the molecular formula C19H17ClN2O and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-chloro-N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide.
| Compound Name | 2-chloro-N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide |
|---|---|
| PubChem CID | 84579227 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-chloro-N-(2,3,4,9-tetrahydro-1H-carbazol-2-yl)benzamide |
| SMILES | O=C(NC1CCc2c([nH]c3ccccc23)C1)c1ccccc1Cl |
| InChI | InChI=1S/C19H17ClN2O/c20-16-7-3-1-6-15(16)19(23)21-12-9-10-14-13-5-2-4-8-17(13)22-18(14)11-12/h1-8,12,22H,9-11H2,(H,21,23) |
| InChIKey | ULFLIJPROCXDCR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|