C13H14N2O2 — CID 84581597
methyl N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamate (PubChem CID 84581597) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamate.
| Compound Name | methyl N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamate |
|---|---|
| PubChem CID | 84581597 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | methyl N-(1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamate |
| SMILES | COC(=O)NC1Cc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C13H14N2O2/c1-17-13(16)14-8-6-10-9-4-2-3-5-11(9)15-12(10)7-8/h2-5,8,15H,6-7H2,1H3,(H,14,16) |
| InChIKey | DTHFVPDUGUJAOT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|