C13H13NO2 — CID 102568781
methyl 1,2,3,4-tetrahydrocyclopenta[b]indole-2-carboxylate (PubChem CID 102568781) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl 1,2,3,4-tetrahydrocyclopenta[b]indole-2-carboxylate.
| Compound Name | methyl 1,2,3,4-tetrahydrocyclopenta[b]indole-2-carboxylate |
|---|---|
| PubChem CID | 102568781 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | methyl 1,2,3,4-tetrahydrocyclopenta[b]indole-2-carboxylate |
| SMILES | COC(=O)C1Cc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C13H13NO2/c1-16-13(15)8-6-10-9-4-2-3-5-11(9)14-12(10)7-8/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | RBOVNFIIDBCXMA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|