C15H18N2O2 — CID 169084126
N-methoxy-N-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 169084126) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-methoxy-N-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-methoxy-N-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 169084126 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-methoxy-N-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | CON(C)C(=O)C1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C15H18N2O2/c1-17(19-2)15(18)10-7-8-14-12(9-10)11-5-3-4-6-13(11)16-14/h3-6,10,16H,7-9H2,1-2H3 |
| InChIKey | BFSNRLGOKLQEEH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|